About 4,7-ditert-butyl-1,3-dihydroinden-2-one
4,7-ditert-butyl-1,3-dihydroinden-2-one (PubChem CID 71145963) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is 4,7-ditert-butyl-1,3-dihydroinden-2-one.
Molecular Properties
| Compound Name | 4,7-ditert-butyl-1,3-dihydroinden-2-one |
| PubChem CID | 71145963 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 4,7-ditert-butyl-1,3-dihydroinden-2-one |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c2c1CC(=O)C2 |
| InChI | InChI=1S/C17H24O/c1-16(2,3)14-7-8-15(17(4,5)6)13-10-11(18)9-12(13)14/h7-8H,9-10H2,1-6H3 |
| InChIKey | LAZKZWUHGSKWRQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,7-ditert-butyl-1,3-dihydroinden-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-ditert-butyl-1,3-dihydroinden-2-one?
The IUPAC name of 4,7-ditert-butyl-1,3-dihydroinden-2-one (CID 71145963) is 4,7-ditert-butyl-1,3-dihydroinden-2-one.
What is the SMILES notation for 4,7-ditert-butyl-1,3-dihydroinden-2-one?
The canonical SMILES for 4,7-ditert-butyl-1,3-dihydroinden-2-one is CC(C)(C)c1ccc(C(C)(C)C)c2c1CC(=O)C2.
What is the InChIKey of 4,7-ditert-butyl-1,3-dihydroinden-2-one?
The InChIKey is LAZKZWUHGSKWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O/c1-16(2,3)14-7-8-15(17(4,5)6)13-10-11(18)9-12(13)14/h7-8H,9-10H2,1-6H3.
What are the key properties of 4,7-ditert-butyl-1,3-dihydroinden-2-one?
4,7-ditert-butyl-1,3-dihydroinden-2-one has a molecular weight of 244.38 g/mol, XLogP of 3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-ditert-butyl-1,3-dihydroinden-2-one is sourced from PubChem (CID 71145963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).