C14H12I2N2 — CID 71145982
N-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]aniline (PubChem CID 71145982) has the molecular formula C14H12I2N2 and a molecular weight of 462.07 g/mol. Its IUPAC name is N-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]aniline.
| Compound Name | N-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 71145982 |
| Molecular Formula | C14H12I2N2 |
| Molecular Weight | 462.07 g/mol |
| Exact Mass | 461.91 |
| IUPAC Name | N-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]aniline |
| SMILES | Cc1c(I)cc(/C=N\Nc2ccccc2)cc1I |
| InChI | InChI=1S/C14H12I2N2/c1-10-13(15)7-11(8-14(10)16)9-17-18-12-5-3-2-4-6-12/h2-9,18H,1H3/b17-9- |
| InChIKey | AWQVCQUABHJFCA-MFOYZWKCSA-N |
| XLogP | 4.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.07 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|