C28H52O4 — CID 71146079
6-hydroxy-16-(3-hydroxy-4,5-dimethylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadecanoic acid (PubChem CID 71146079) has the molecular formula C28H52O4 and a molecular weight of 452.72 g/mol. Its IUPAC name is 6-hydroxy-16-(3-hydroxy-4,5-dimethylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadecanoic acid.
| Compound Name | 6-hydroxy-16-(3-hydroxy-4,5-dimethylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadecanoic acid |
|---|---|
| PubChem CID | 71146079 |
| Molecular Formula | C28H52O4 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.39 |
| IUPAC Name | 6-hydroxy-16-(3-hydroxy-4,5-dimethylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadecanoic acid |
| SMILES | CC(CCCC(C)CCC1=CC(O)C(C)C(C)C1)CCCC(C)(O)CCCC(C)C(=O)O |
| InChI | InChI=1S/C28H52O4/c1-20(12-8-16-28(6,32)17-9-13-22(3)27(30)31)10-7-11-21(2)14-15-25-18-23(4)24(5)26(29)19-25/h19-24,26,29,32H,7-18H2,1-6H3,(H,30,31) |
| InChIKey | SEYNYHYWXLVKFS-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|