C25H21F4NO3S — CID 71146161
(E)-1-[5-[(4-fluorophenyl)sulfonyl-(2,3,6-trifluorophenyl)methyl]-4-methyl-2-pyridinyl]-3-methylpent-2-en-1-one (PubChem CID 71146161) has the molecular formula C25H21F4NO3S and a molecular weight of 491.51 g/mol. Its IUPAC name is (E)-1-[5-[(4-fluorophenyl)sulfonyl-(2,3,6-trifluorophenyl)methyl]-4-methyl-2-pyridinyl]-3-methylpent-2-en-1-one.
| Compound Name | (E)-1-[5-[(4-fluorophenyl)sulfonyl-(2,3,6-trifluorophenyl)methyl]-4-methyl-2-pyridinyl]-3-methylpent-2-en-1-one |
|---|---|
| PubChem CID | 71146161 |
| Molecular Formula | C25H21F4NO3S |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | (E)-1-[5-[(4-fluorophenyl)sulfonyl-(2,3,6-trifluorophenyl)methyl]-4-methyl-2-pyridinyl]-3-methylpent-2-en-1-one |
| SMILES | CC/C(C)=C/C(=O)c1cc(C)c(C(c2c(F)ccc(F)c2F)S(=O)(=O)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C25H21F4NO3S/c1-4-14(2)11-22(31)21-12-15(3)18(13-30-21)25(23-19(27)9-10-20(28)24(23)29)34(32,33)17-7-5-16(26)6-8-17/h5-13,25H,4H2,1-3H3/b14-11+ |
| InChIKey | DRAPMNXKEXOLKW-SDNWHVSQSA-N |
| XLogP | 6.05 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|