C22H31N3O8 — CID 7114645
methyl (2R)-2-[[(1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-1,4,5-trihydroxycyclohexanecarbonyl]amino]-3-methylbutanoate (PubChem CID 7114645) has the molecular formula C22H31N3O8 and a molecular weight of 465.50 g/mol. Its IUPAC name is methyl (2R)-2-[[(1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-1,4,5-trihydroxycyclohexanecarbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2R)-2-[[(1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-1,4,5-trihydroxycyclohexanecarbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7114645 |
| Molecular Formula | C22H31N3O8 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | methyl (2R)-2-[[(1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-1,4,5-trihydroxycyclohexanecarbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@H](NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2ccc(C(C)=O)cc2)C1)C(C)C |
| InChI | InChI=1S/C22H31N3O8/c1-11(2)17(19(29)33-4)25-20(30)22(32)9-15(18(28)16(27)10-22)24-21(31)23-14-7-5-13(6-8-14)12(3)26/h5-8,11,15-18,27-28,32H,9-10H2,1-4H3,(H,25,30)(H2,23,24,31)/t15-,16+,17+,18+,22-/m0/s1 |
| InChIKey | QSBBLWORMUJXRW-HTXDQZCYSA-N |
| XLogP | -0.06 |
| TPSA | 174.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |