About N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide
N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide (PubChem CID 71146453) has the molecular formula C15H23N3O4S
and a molecular weight of 341.43 g/mol. Its IUPAC name is N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide |
| PubChem CID | 71146453 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide |
| SMILES | CCCCOc1ccc(OCC2=NCCN2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C15H23N3O4S/c1-3-4-9-21-14-6-5-12(10-13(14)18-23(2,19)20)22-11-15-16-7-8-17-15/h5-6,10,18H,3-4,7-9,11H2,1-2H3,(H,16,17) |
| InChIKey | IOWQFFCAXNZHRM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide?
The IUPAC name of N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide (CID 71146453) is N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide.
What is the SMILES notation for N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide?
The canonical SMILES for N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide is CCCCOc1ccc(OCC2=NCCN2)cc1NS(C)(=O)=O.
What is the InChIKey of N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide?
The InChIKey is IOWQFFCAXNZHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O4S/c1-3-4-9-21-14-6-5-12(10-13(14)18-23(2,19)20)22-11-15-16-7-8-17-15/h5-6,10,18H,3-4,7-9,11H2,1-2H3,(H,16,17).
What are the key properties of N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide?
N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide has a molecular weight of 341.43 g/mol, XLogP of 1.62, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-butoxy-5-(4,5-dihydro-1H-imidazol-2-ylmethoxy)phenyl]methanesulfonamide is sourced from PubChem (CID 71146453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).