C22H32N4O7 — CID 7114646
(1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,4,5-trihydroxycyclohexane-1-carboxamide (PubChem CID 7114646) has the molecular formula C22H32N4O7 and a molecular weight of 464.52 g/mol. Its IUPAC name is (1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,4,5-trihydroxycyclohexane-1-carboxamide.
| Compound Name | (1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,4,5-trihydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7114646 |
| Molecular Formula | C22H32N4O7 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (1S,3S,4R,5R)-3-[(4-acetylphenyl)carbamoylamino]-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,4,5-trihydroxycyclohexane-1-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)N[C@H]2C[C@@](O)(C(=O)N[C@H](CC(C)C)C(N)=O)C[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C22H32N4O7/c1-11(2)8-15(19(23)30)25-20(31)22(33)9-16(18(29)17(28)10-22)26-21(32)24-14-6-4-13(5-7-14)12(3)27/h4-7,11,15-18,28-29,33H,8-10H2,1-3H3,(H2,23,30)(H,25,31)(H2,24,26,32)/t15-,16+,17-,18-,22+/m1/s1 |
| InChIKey | CWOFIXSKWXOBHX-HUTLHSBBSA-N |
| XLogP | -0.36 |
| TPSA | 191.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |