C21H28F3N3O8 — CID 7114660
methyl (2R)-3-methyl-2-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexanecarbonyl]amino]butanoate (PubChem CID 7114660) has the molecular formula C21H28F3N3O8 and a molecular weight of 507.46 g/mol. Its IUPAC name is methyl (2R)-3-methyl-2-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexanecarbonyl]amino]butanoate.
| Compound Name | methyl (2R)-3-methyl-2-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexanecarbonyl]amino]butanoate |
|---|---|
| PubChem CID | 7114660 |
| Molecular Formula | C21H28F3N3O8 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | methyl (2R)-3-methyl-2-[[(1S,3R,4R,5S)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexanecarbonyl]amino]butanoate |
| SMILES | COC(=O)[C@H](NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2ccc(OC(F)(F)F)cc2)C1)C(C)C |
| InChI | InChI=1S/C21H28F3N3O8/c1-10(2)15(17(30)34-3)27-18(31)20(33)8-13(16(29)14(28)9-20)26-19(32)25-11-4-6-12(7-5-11)35-21(22,23)24/h4-7,10,13-16,28-29,33H,8-9H2,1-3H3,(H,27,31)(H2,25,26,32)/t13-,14+,15+,16+,20-/m0/s1 |
| InChIKey | SVUBZZNAVIRUKN-BUZFHVMYSA-N |
| XLogP | 0.64 |
| TPSA | 166.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |