4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid

C8H13F3N2O4 — CID 71146877

IUPAC4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid
SMILESCN1CCOC(C(N)=O)C1.O=C(O)C(F)(F)F
InChIInChI=1S/C6H12N2O2.C2HF3O2/c1-8-2-3-10-5(4-8)6(7)9;3-2(4,5)1(6)7/h5H,2-4H2,1H3,(H2,7,9);(H,6,7)
InChIKeyDKNKPIAMWUILAH-UHFFFAOYSA-N
MW258.20 g/mol
LogP-0.56
Rot. Bonds1

About 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid

4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 71146877) has the molecular formula C8H13F3N2O4 and a molecular weight of 258.20 g/mol. Its IUPAC name is 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid
PubChem CID71146877
Molecular FormulaC8H13F3N2O4
Molecular Weight258.20 g/mol
Exact Mass258.08
IUPAC Name4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid
SMILESCN1CCOC(C(N)=O)C1.O=C(O)C(F)(F)F
InChIInChI=1S/C6H12N2O2.C2HF3O2/c1-8-2-3-10-5(4-8)6(7)9;3-2(4,5)1(6)7/h5H,2-4H2,1H3,(H2,7,9);(H,6,7)
InChIKeyDKNKPIAMWUILAH-UHFFFAOYSA-N
XLogP-0.56
TPSA92.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.20
LogP ≤ 5-0.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid?
The IUPAC name of 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid (CID 71146877) is 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid?
The canonical SMILES for 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid is CN1CCOC(C(N)=O)C1.O=C(O)C(F)(F)F.
What is the InChIKey of 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid?
The InChIKey is DKNKPIAMWUILAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.C2HF3O2/c1-8-2-3-10-5(4-8)6(7)9;3-2(4,5)1(6)7/h5H,2-4H2,1H3,(H2,7,9);(H,6,7).
What are the key properties of 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid?
4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid has a molecular weight of 258.20 g/mol, XLogP of -0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylmorpholine-2-carboxamide;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 71146877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).