C20H15Cl2F3N6O2 — CID 71146879
5-(4-chlorophenyl)-2-[[3-(2-chlorophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 71146879) has the molecular formula C20H15Cl2F3N6O2 and a molecular weight of 499.28 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[3-(2-chlorophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[3-(2-chlorophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 71146879 |
| Molecular Formula | C20H15Cl2F3N6O2 |
| Molecular Weight | 499.28 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[3-(2-chlorophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | O=c1n(Cc2nc(-c3ccccc3Cl)n[nH]2)nc(-c2ccc(Cl)cc2)n1C[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C20H15Cl2F3N6O2/c21-12-7-5-11(6-8-12)18-29-31(19(33)30(18)9-15(32)20(23,24)25)10-16-26-17(28-27-16)13-3-1-2-4-14(13)22/h1-8,15,32H,9-10H2,(H,26,27,28)/t15-/m0/s1 |
| InChIKey | QGLQQPXHJMQTAB-HNNXBMFYSA-N |
| XLogP | 3.78 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |