C29H28BF3N2O2 — CID 71146998
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-tritylpyrazole (PubChem CID 71146998) has the molecular formula C29H28BF3N2O2 and a molecular weight of 504.36 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-tritylpyrazole.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-tritylpyrazole |
|---|---|
| PubChem CID | 71146998 |
| Molecular Formula | C29H28BF3N2O2 |
| Molecular Weight | 504.36 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-tritylpyrazole |
| SMILES | CC1(C)OB(c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)nc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C29H28BF3N2O2/c1-26(2)27(3,4)37-30(36-26)24-20-35(34-25(24)29(31,32)33)28(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20H,1-4H3 |
| InChIKey | OYGIXDZRMBMPCD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.36 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|