About 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine
1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine (PubChem CID 71147185) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine.
Molecular Properties
| Compound Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine |
| PubChem CID | 71147185 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine |
| SMILES | C1=CCCC(C(C2=COC=CO2)N2CCCCC2)=C1 |
| InChI | InChI=1S/C16H21NO2/c1-3-7-14(8-4-1)16(15-13-18-11-12-19-15)17-9-5-2-6-10-17/h1,3,7,11-13,16H,2,4-6,8-10H2 |
| InChIKey | LYYQPFRGIFJUTA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine?
The IUPAC name of 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine (CID 71147185) is 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine.
What is the SMILES notation for 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine?
The canonical SMILES for 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine is C1=CCCC(C(C2=COC=CO2)N2CCCCC2)=C1.
What is the InChIKey of 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine?
The InChIKey is LYYQPFRGIFJUTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2/c1-3-7-14(8-4-1)16(15-13-18-11-12-19-15)17-9-5-2-6-10-17/h1,3,7,11-13,16H,2,4-6,8-10H2.
What are the key properties of 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine?
1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine has a molecular weight of 259.35 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidine is sourced from PubChem (CID 71147185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).