C23H33N3O2 — CID 71147510
cyclohexane;[2-[(propan-2-ylamino)methyl]phenyl]-(pyridin-3-ylmethyl)carbamic acid (PubChem CID 71147510) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is cyclohexane;[2-[(propan-2-ylamino)methyl]phenyl]-(pyridin-3-ylmethyl)carbamic acid.
| Compound Name | cyclohexane;[2-[(propan-2-ylamino)methyl]phenyl]-(pyridin-3-ylmethyl)carbamic acid |
|---|---|
| PubChem CID | 71147510 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | cyclohexane;[2-[(propan-2-ylamino)methyl]phenyl]-(pyridin-3-ylmethyl)carbamic acid |
| SMILES | C1CCCCC1.CC(C)NCc1ccccc1N(Cc1cccnc1)C(=O)O |
| InChI | InChI=1S/C17H21N3O2.C6H12/c1-13(2)19-11-15-7-3-4-8-16(15)20(17(21)22)12-14-6-5-9-18-10-14;1-2-4-6-5-3-1/h3-10,13,19H,11-12H2,1-2H3,(H,21,22);1-6H2 |
| InChIKey | VWRCFSOGQOKODO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |