C33H27F2N11O3 — CID 71148021
7-N-[(1S)-5-(1-aminotetrazol-5-yl)-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-methyl-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide (PubChem CID 71148021) has the molecular formula C33H27F2N11O3 and a molecular weight of 663.65 g/mol. Its IUPAC name is 7-N-[(1S)-5-(1-aminotetrazol-5-yl)-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-methyl-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide.
| Compound Name | 7-N-[(1S)-5-(1-aminotetrazol-5-yl)-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-methyl-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide |
|---|---|
| PubChem CID | 71148021 |
| Molecular Formula | C33H27F2N11O3 |
| Molecular Weight | 663.65 g/mol |
| Exact Mass | 663.23 |
| IUPAC Name | 7-N-[(1S)-5-(1-aminotetrazol-5-yl)-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-methyl-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide |
| SMILES | CN(C(=O)c1cnn2c(C(=O)N[C@H]3CCc4cc(-c5nnnn5N)ccc43)cc(C(=O)NCc3ccc(F)c(F)c3)nc12)c1ccccc1 |
| InChI | InChI=1S/C33H27F2N11O3/c1-44(21-5-3-2-4-6-21)33(49)23-17-38-45-28(15-27(39-30(23)45)31(47)37-16-18-7-11-24(34)25(35)13-18)32(48)40-26-12-9-19-14-20(8-10-22(19)26)29-41-42-43-46(29)36/h2-8,10-11,13-15,17,26H,9,12,16,36H2,1H3,(H,37,47)(H,40,48)/t26-/m0/s1 |
| InChIKey | KGXYURFQKMUKOP-SANMLTNESA-N |
| XLogP | 3.00 |
| TPSA | 178.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |