C7H14NO6+ — CID 71148369
1-hydroxy-2,6-bis(hydroxymethyl)-2,3,4,5-tetrahydropyridin-1-ium-3,4,5-triol (PubChem CID 71148369) has the molecular formula C7H14NO6+ and a molecular weight of 208.19 g/mol. Its IUPAC name is 1-hydroxy-2,6-bis(hydroxymethyl)-2,3,4,5-tetrahydropyridin-1-ium-3,4,5-triol.
| Compound Name | 1-hydroxy-2,6-bis(hydroxymethyl)-2,3,4,5-tetrahydropyridin-1-ium-3,4,5-triol |
|---|---|
| PubChem CID | 71148369 |
| Molecular Formula | C7H14NO6+ |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 1-hydroxy-2,6-bis(hydroxymethyl)-2,3,4,5-tetrahydropyridin-1-ium-3,4,5-triol |
| SMILES | OCC1=[N+](O)C(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C7H14NO6/c9-1-3-5(11)7(13)6(12)4(2-10)8(3)14/h3,5-7,9-14H,1-2H2/q+1 |
| InChIKey | CDVLQGYRFFRRPD-UHFFFAOYSA-N |
| XLogP | -3.72 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|