C26H40OS — CID 71148378
(2S)-1-[(1R)-4-[(2R,3aS,7S)-2-methyl-7-[(3R)-3-methylcyclohexyl]-2,3,3a,4,7,7a-hexahydro-1-benzothiophen-5-yl]cyclohexa-2,4-dien-1-yl]butan-2-ol (PubChem CID 71148378) has the molecular formula C26H40OS and a molecular weight of 400.67 g/mol. Its IUPAC name is (2S)-1-[(1R)-4-[(2R,3aS,7S)-2-methyl-7-[(3R)-3-methylcyclohexyl]-2,3,3a,4,7,7a-hexahydro-1-benzothiophen-5-yl]cyclohexa-2,4-dien-1-yl]butan-2-ol.
| Compound Name | (2S)-1-[(1R)-4-[(2R,3aS,7S)-2-methyl-7-[(3R)-3-methylcyclohexyl]-2,3,3a,4,7,7a-hexahydro-1-benzothiophen-5-yl]cyclohexa-2,4-dien-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 71148378 |
| Molecular Formula | C26H40OS |
| Molecular Weight | 400.67 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (2S)-1-[(1R)-4-[(2R,3aS,7S)-2-methyl-7-[(3R)-3-methylcyclohexyl]-2,3,3a,4,7,7a-hexahydro-1-benzothiophen-5-yl]cyclohexa-2,4-dien-1-yl]butan-2-ol |
| SMILES | CC[C@H](O)C[C@@H]1C=CC(C2=C[C@H](C3CCC[C@@H](C)C3)C3S[C@H](C)C[C@@H]3C2)=CC1 |
| InChI | InChI=1S/C26H40OS/c1-4-24(27)14-19-8-10-20(11-9-19)22-15-23-13-18(3)28-26(23)25(16-22)21-7-5-6-17(2)12-21/h8,10-11,16-19,21,23-27H,4-7,9,12-15H2,1-3H3/t17-,18-,19-,21?,23-,24+,25-,26?/m1/s1 |
| InChIKey | JYMCWFPAXFMTIM-VITUXORHSA-N |
| XLogP | 6.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |