About 3-methyl-6-octyl-3,4-dihydropyridine
3-methyl-6-octyl-3,4-dihydropyridine (PubChem CID 71148391) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 3-methyl-6-octyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 3-methyl-6-octyl-3,4-dihydropyridine |
| PubChem CID | 71148391 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 3-methyl-6-octyl-3,4-dihydropyridine |
| SMILES | CCCCCCCCC1=CCC(C)C=N1 |
| InChI | InChI=1S/C14H25N/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-15-14/h11-13H,3-10H2,1-2H3 |
| InChIKey | JGGPOWKHCHWZRT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-6-octyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-octyl-3,4-dihydropyridine?
The IUPAC name of 3-methyl-6-octyl-3,4-dihydropyridine (CID 71148391) is 3-methyl-6-octyl-3,4-dihydropyridine.
What is the SMILES notation for 3-methyl-6-octyl-3,4-dihydropyridine?
The canonical SMILES for 3-methyl-6-octyl-3,4-dihydropyridine is CCCCCCCCC1=CCC(C)C=N1.
What is the InChIKey of 3-methyl-6-octyl-3,4-dihydropyridine?
The InChIKey is JGGPOWKHCHWZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-15-14/h11-13H,3-10H2,1-2H3.
What are the key properties of 3-methyl-6-octyl-3,4-dihydropyridine?
3-methyl-6-octyl-3,4-dihydropyridine has a molecular weight of 207.36 g/mol, XLogP of 4.73, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-octyl-3,4-dihydropyridine is sourced from PubChem (CID 71148391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).