About (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole
(2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole (PubChem CID 71148411) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole |
| PubChem CID | 71148411 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole |
| SMILES | CCCCOC[C@H]1C[C@H](OCCCC)C=N1 |
| InChI | InChI=1S/C13H25NO2/c1-3-5-7-15-11-12-9-13(10-14-12)16-8-6-4-2/h10,12-13H,3-9,11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | DWJZGZPVWCNTFP-OLZOCXBDSA-N |
| XLogP | 2.83 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole?
The IUPAC name of (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole (CID 71148411) is (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole?
The canonical SMILES for (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole is CCCCOC[C@H]1C[C@H](OCCCC)C=N1.
What is the InChIKey of (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole?
The InChIKey is DWJZGZPVWCNTFP-OLZOCXBDSA-N. The full InChI is InChI=1S/C13H25NO2/c1-3-5-7-15-11-12-9-13(10-14-12)16-8-6-4-2/h10,12-13H,3-9,11H2,1-2H3/t12-,13+/m1/s1.
What are the key properties of (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole?
(2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole has a molecular weight of 227.35 g/mol, XLogP of 2.83, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-4-butoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 71148411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).