C22H31N3O8 — CID 71148569
2-(4-aminobutyl)propanedioic acid;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione (PubChem CID 71148569) has the molecular formula C22H31N3O8 and a molecular weight of 465.50 g/mol. Its IUPAC name is 2-(4-aminobutyl)propanedioic acid;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione.
| Compound Name | 2-(4-aminobutyl)propanedioic acid;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 71148569 |
| Molecular Formula | C22H31N3O8 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-(4-aminobutyl)propanedioic acid;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione |
| SMILES | NCCCCC(C(=O)O)C(=O)O.O=C1C=CC(=O)N1CC1CCC(N2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C15H18N2O4.C7H13NO4/c18-12-5-6-13(19)16(12)9-10-1-3-11(4-2-10)17-14(20)7-8-15(17)21;8-4-2-1-3-5(6(9)10)7(11)12/h5-6,10-11H,1-4,7-9H2;5H,1-4,8H2,(H,9,10)(H,11,12) |
| InChIKey | SNLJSCYIYFLJNZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 175.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|