C17H10N2O4 — CID 7114899
(3R,4R)-4-(furan-2-yl)-2-imino-5-oxo-3,4-dihydropyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 7114899) has the molecular formula C17H10N2O4 and a molecular weight of 306.28 g/mol. Its IUPAC name is (3R,4R)-4-(furan-2-yl)-2-imino-5-oxo-3,4-dihydropyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | (3R,4R)-4-(furan-2-yl)-2-imino-5-oxo-3,4-dihydropyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 7114899 |
| Molecular Formula | C17H10N2O4 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (3R,4R)-4-(furan-2-yl)-2-imino-5-oxo-3,4-dihydropyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(c(=O)oc3ccccc23)[C@H](c2ccco2)[C@@H]1C#N |
| InChI | InChI=1S/C17H10N2O4/c18-8-10-13(12-6-3-7-21-12)14-15(23-16(10)19)9-4-1-2-5-11(9)22-17(14)20/h1-7,10,13,19H/b19-16-/t10-,13-/m0/s1 |
| InChIKey | QJLDLTHYQGJTQG-YUIZJEFLSA-N |
| XLogP | 3.03 |
| TPSA | 100.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|