About 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane
4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane (PubChem CID 71149111) has the molecular formula C9H18O4S2
and a molecular weight of 254.37 g/mol. Its IUPAC name is 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane |
| PubChem CID | 71149111 |
| Molecular Formula | C9H18O4S2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane |
| SMILES | CCS(=O)CC1OCOC1CS(=O)CC |
| InChI | InChI=1S/C9H18O4S2/c1-3-14(10)5-8-9(13-7-12-8)6-15(11)4-2/h8-9H,3-7H2,1-2H3 |
| InChIKey | QCCUTLMVXLJHDI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane?
The IUPAC name of 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane (CID 71149111) is 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane.
What is the SMILES notation for 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane?
The canonical SMILES for 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane is CCS(=O)CC1OCOC1CS(=O)CC.
What is the InChIKey of 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane?
The InChIKey is QCCUTLMVXLJHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4S2/c1-3-14(10)5-8-9(13-7-12-8)6-15(11)4-2/h8-9H,3-7H2,1-2H3.
What are the key properties of 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane?
4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane has a molecular weight of 254.37 g/mol, XLogP of 0.27, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethylsulfinylmethyl)-1,3-dioxolane is sourced from PubChem (CID 71149111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).