C16H19IN2O2 — CID 71149547
2-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-iodophenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 71149547) has the molecular formula C16H19IN2O2 and a molecular weight of 398.24 g/mol. Its IUPAC name is 2-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-iodophenyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-iodophenyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 71149547 |
| Molecular Formula | C16H19IN2O2 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-[3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-iodophenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2cccc(C3=NC(C)(C)CO3)c2I)=N1 |
| InChI | InChI=1S/C16H19IN2O2/c1-15(2)8-20-13(18-15)10-6-5-7-11(12(10)17)14-19-16(3,4)9-21-14/h5-7H,8-9H2,1-4H3 |
| InChIKey | WWNFIJZMFVITJA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|