C24H17F2N3O — CID 71149559
3,3-difluoro-7-pyridin-4-yl-2-(2-quinolin-2-ylethyl)isoindol-1-one (PubChem CID 71149559) has the molecular formula C24H17F2N3O and a molecular weight of 401.42 g/mol. Its IUPAC name is 3,3-difluoro-7-pyridin-4-yl-2-(2-quinolin-2-ylethyl)isoindol-1-one.
| Compound Name | 3,3-difluoro-7-pyridin-4-yl-2-(2-quinolin-2-ylethyl)isoindol-1-one |
|---|---|
| PubChem CID | 71149559 |
| Molecular Formula | C24H17F2N3O |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3,3-difluoro-7-pyridin-4-yl-2-(2-quinolin-2-ylethyl)isoindol-1-one |
| SMILES | O=C1c2c(-c3ccncc3)cccc2C(F)(F)N1CCc1ccc2ccccc2n1 |
| InChI | InChI=1S/C24H17F2N3O/c25-24(26)20-6-3-5-19(16-10-13-27-14-11-16)22(20)23(30)29(24)15-12-18-9-8-17-4-1-2-7-21(17)28-18/h1-11,13-14H,12,15H2 |
| InChIKey | OTXYKOZAQXRSPR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|