About 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine
4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine (PubChem CID 71150236) has the molecular formula C14H19N3S2
and a molecular weight of 293.46 g/mol. Its IUPAC name is 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine.
Molecular Properties
| Compound Name | 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine |
| PubChem CID | 71150236 |
| Molecular Formula | C14H19N3S2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine |
| SMILES | CCSc1cc(C#N)c(C#N)cc1SCC.CNC |
| InChI | InChI=1S/C12H12N2S2.C2H7N/c1-3-15-11-5-9(7-13)10(8-14)6-12(11)16-4-2;1-3-2/h5-6H,3-4H2,1-2H3;3H,1-2H3 |
| InChIKey | HDPPKNNAUBZHAQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine?
The IUPAC name of 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine (CID 71150236) is 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine.
What is the SMILES notation for 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine?
The canonical SMILES for 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine is CCSc1cc(C#N)c(C#N)cc1SCC.CNC.
What is the InChIKey of 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine?
The InChIKey is HDPPKNNAUBZHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S2.C2H7N/c1-3-15-11-5-9(7-13)10(8-14)6-12(11)16-4-2;1-3-2/h5-6H,3-4H2,1-2H3;3H,1-2H3.
What are the key properties of 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine?
4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine has a molecular weight of 293.46 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethylsulfanyl)benzene-1,2-dicarbonitrile;N-methylmethanamine is sourced from PubChem (CID 71150236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).