C14H20O9 — CID 71150621
1-[(2S,3S,4R,5S)-4,5,6-triacetyl-3,4,5,6-tetrahydroxy-2-methyloxan-3-yl]ethanone (PubChem CID 71150621) has the molecular formula C14H20O9 and a molecular weight of 332.31 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5S)-4,5,6-triacetyl-3,4,5,6-tetrahydroxy-2-methyloxan-3-yl]ethanone.
| Compound Name | 1-[(2S,3S,4R,5S)-4,5,6-triacetyl-3,4,5,6-tetrahydroxy-2-methyloxan-3-yl]ethanone |
|---|---|
| PubChem CID | 71150621 |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-[(2S,3S,4R,5S)-4,5,6-triacetyl-3,4,5,6-tetrahydroxy-2-methyloxan-3-yl]ethanone |
| SMILES | CC(=O)C1(O)O[C@@H](C)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C14H20O9/c1-6(15)11(19)10(5)23-14(22,9(4)18)13(21,8(3)17)12(11,20)7(2)16/h10,19-22H,1-5H3/t10-,11-,12+,13+,14?/m0/s1 |
| InChIKey | ZYLCBTHPCHZXBV-UKIXVXPJSA-N |
| XLogP | -2.36 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |