C30H39N5O2S — CID 71151764
3-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-5,5-di(propan-2-yl)imidazolidine-2,4-dione (PubChem CID 71151764) has the molecular formula C30H39N5O2S and a molecular weight of 533.74 g/mol. Its IUPAC name is 3-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-5,5-di(propan-2-yl)imidazolidine-2,4-dione.
| Compound Name | 3-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-5,5-di(propan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71151764 |
| Molecular Formula | C30H39N5O2S |
| Molecular Weight | 533.74 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 3-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-5,5-di(propan-2-yl)imidazolidine-2,4-dione |
| SMILES | CC(C)C1(C(C)C)NC(=O)N(CCCCN2CCN(C3=Nc4ccccc4Sc4ccccc43)CC2)C1=O |
| InChI | InChI=1S/C30H39N5O2S/c1-21(2)30(22(3)4)28(36)35(29(37)32-30)16-10-9-15-33-17-19-34(20-18-33)27-23-11-5-7-13-25(23)38-26-14-8-6-12-24(26)31-27/h5-8,11-14,21-22H,9-10,15-20H2,1-4H3,(H,32,37) |
| InChIKey | OHBNDXFDHUMJNV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.74 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|