C19H15N5O4S2 — CID 71152098
4-[3-[[1-hydroxy-4-(sulfinoamino)naphthalene-2-carbonyl]amino]phenyl]-5-sulfanylidene-1H-1,2,4-triazole (PubChem CID 71152098) has the molecular formula C19H15N5O4S2 and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-[3-[[1-hydroxy-4-(sulfinoamino)naphthalene-2-carbonyl]amino]phenyl]-5-sulfanylidene-1H-1,2,4-triazole.
| Compound Name | 4-[3-[[1-hydroxy-4-(sulfinoamino)naphthalene-2-carbonyl]amino]phenyl]-5-sulfanylidene-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 71152098 |
| Molecular Formula | C19H15N5O4S2 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 4-[3-[[1-hydroxy-4-(sulfinoamino)naphthalene-2-carbonyl]amino]phenyl]-5-sulfanylidene-1H-1,2,4-triazole |
| SMILES | O=C(Nc1cccc(-n2cn[nH]c2=S)c1)c1cc(NS(=O)O)c2ccccc2c1O |
| InChI | InChI=1S/C19H15N5O4S2/c25-17-14-7-2-1-6-13(14)16(23-30(27)28)9-15(17)18(26)21-11-4-3-5-12(8-11)24-10-20-22-19(24)29/h1-10,23,25H,(H,21,26)(H,22,29)(H,27,28) |
| InChIKey | WXEAMLZYIZPWBY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|