About 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine
4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine (PubChem CID 71152103) has the molecular formula C28H31FN2O2Si
and a molecular weight of 474.65 g/mol. Its IUPAC name is 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine.
Molecular Properties
| Compound Name | 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine |
| PubChem CID | 71152103 |
| Molecular Formula | C28H31FN2O2Si |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2ncc3cc([Si](C)(C)C)ccc3c2F)cc1 |
| InChI | InChI=1S/C28H31FN2O2Si/c1-32-23-10-6-20(7-11-23)18-31(19-21-8-12-24(33-2)13-9-21)28-27(29)26-15-14-25(34(3,4)5)16-22(26)17-30-28/h6-17H,18-19H2,1-5H3 |
| InChIKey | BYFRCNIEFOLSSA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine?
The IUPAC name of 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine (CID 71152103) is 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine.
What is the SMILES notation for 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine?
The canonical SMILES for 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine is COc1ccc(CN(Cc2ccc(OC)cc2)c2ncc3cc([Si](C)(C)C)ccc3c2F)cc1.
What is the InChIKey of 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine?
The InChIKey is BYFRCNIEFOLSSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31FN2O2Si/c1-32-23-10-6-20(7-11-23)18-31(19-21-8-12-24(33-2)13-9-21)28-27(29)26-15-14-25(34(3,4)5)16-22(26)17-30-28/h6-17H,18-19H2,1-5H3.
What are the key properties of 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine?
4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine has a molecular weight of 474.65 g/mol, XLogP of 6.14, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-7-trimethylsilylisoquinolin-3-amine is sourced from PubChem (CID 71152103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).