C20H22BFN4O2 — CID 71153052
8-fluoro-N-methyl-2-pyridin-3-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-amine (PubChem CID 71153052) has the molecular formula C20H22BFN4O2 and a molecular weight of 380.23 g/mol. Its IUPAC name is 8-fluoro-N-methyl-2-pyridin-3-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-amine.
| Compound Name | 8-fluoro-N-methyl-2-pyridin-3-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 71153052 |
| Molecular Formula | C20H22BFN4O2 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 8-fluoro-N-methyl-2-pyridin-3-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-amine |
| SMILES | CNc1nc(-c2cccnc2)nc2c(F)c(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C20H22BFN4O2/c1-19(2)20(3,4)28-21(27-19)14-9-8-13-16(15(14)22)25-17(26-18(13)23-5)12-7-6-10-24-11-12/h6-11H,1-5H3,(H,23,25,26) |
| InChIKey | KKXHPSNQBKKDEP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|