C22H20N6 — CID 71153331
2-[2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-7-yl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 71153331) has the molecular formula C22H20N6 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-7-yl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 2-[2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-7-yl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 71153331 |
| Molecular Formula | C22H20N6 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-7-yl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | Cc1ccc(-c2cn3ccc(-c4nc5c(C)ncc(C)n5n4)cc3n2)c(C)c1 |
| InChI | InChI=1S/C22H20N6/c1-13-5-6-18(14(2)9-13)19-12-27-8-7-17(10-20(27)24-19)21-25-22-16(4)23-11-15(3)28(22)26-21/h5-12H,1-4H3 |
| InChIKey | VVPPGWHZZRJHHT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |