C19H18ClN5O — CID 71153354
1-(2-chlorophenyl)-N-(2-methoxyethyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-amine (PubChem CID 71153354) has the molecular formula C19H18ClN5O and a molecular weight of 367.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(2-methoxyethyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-amine.
| Compound Name | 1-(2-chlorophenyl)-N-(2-methoxyethyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-amine |
|---|---|
| PubChem CID | 71153354 |
| Molecular Formula | C19H18ClN5O |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(2-methoxyethyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-amine |
| SMILES | COCCNc1ccc2nc(C)c3nnc(-c4ccccc4Cl)n3c2c1 |
| InChI | InChI=1S/C19H18ClN5O/c1-12-18-23-24-19(14-5-3-4-6-15(14)20)25(18)17-11-13(21-9-10-26-2)7-8-16(17)22-12/h3-8,11,21H,9-10H2,1-2H3 |
| InChIKey | OJADSQAKVCVDIT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|