About 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine
9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine (PubChem CID 71154159) has the molecular formula C18H15N3OS
and a molecular weight of 321.40 g/mol. Its IUPAC name is 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine.
Molecular Properties
| Compound Name | 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine |
| PubChem CID | 71154159 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine |
| SMILES | COC1=CC=CC(=C1)NC2=C3C(=NC=C2N)C=CC4=C3SC=C4 |
| InChI | InChI=1S/C18H15N3OS/c1-22-13-4-2-3-12(9-13)21-17-14(19)10-20-15-6-5-11-7-8-23-18(11)16(15)17/h2-10H,19H2,1H3,(H,20,21) |
| InChIKey | NZNLOYSSWBSYCQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | 410 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine?
The IUPAC name of 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine (CID 71154159) is 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine.
What is the SMILES notation for 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine?
The canonical SMILES for 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine is COC1=CC=CC(=C1)NC2=C3C(=NC=C2N)C=CC4=C3SC=C4.
What is the InChIKey of 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine?
The InChIKey is NZNLOYSSWBSYCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3OS/c1-22-13-4-2-3-12(9-13)21-17-14(19)10-20-15-6-5-11-7-8-23-18(11)16(15)17/h2-10H,19H2,1H3,(H,20,21).
What are the key properties of 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine?
9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine has a molecular weight of 321.40 g/mol, XLogP of 4.00, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-N-(3-methoxyphenyl)thieno[2,3-f]quinoline-8,9-diamine is sourced from PubChem (CID 71154159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).