About N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine
N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine (PubChem CID 71154231) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine |
| PubChem CID | 71154231 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine |
| SMILES | COCN(CC1=C(N)C=CCC1)C1CCNCC1 |
| InChI | InChI=1S/C14H25N3O/c1-18-11-17(13-6-8-16-9-7-13)10-12-4-2-3-5-14(12)15/h3,5,13,16H,2,4,6-11,15H2,1H3 |
| InChIKey | KPAWTEORBWUDBU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine?
The IUPAC name of N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine (CID 71154231) is N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine.
What is the SMILES notation for N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine?
The canonical SMILES for N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine is COCN(CC1=C(N)C=CCC1)C1CCNCC1.
What is the InChIKey of N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine?
The InChIKey is KPAWTEORBWUDBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c1-18-11-17(13-6-8-16-9-7-13)10-12-4-2-3-5-14(12)15/h3,5,13,16H,2,4,6-11,15H2,1H3.
What are the key properties of N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine?
N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine has a molecular weight of 251.37 g/mol, XLogP of 1.21, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-aminocyclohexa-1,3-dien-1-yl)methyl]-N-(methoxymethyl)piperidin-4-amine is sourced from PubChem (CID 71154231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).