About 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one
6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one (PubChem CID 71154518) has the molecular formula C17H33NO
and a molecular weight of 267.46 g/mol. Its IUPAC name is 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one.
Molecular Properties
| Compound Name | 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one |
| PubChem CID | 71154518 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one |
| SMILES | CCNC(CC(C)(C)C1CCCC1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H33NO/c1-7-18-14(15(19)16(2,3)4)12-17(5,6)13-10-8-9-11-13/h13-14,18H,7-12H2,1-6H3 |
| InChIKey | SCJLFJRBOSSSJT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one?
The IUPAC name of 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one (CID 71154518) is 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one.
What is the SMILES notation for 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one?
The canonical SMILES for 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one is CCNC(CC(C)(C)C1CCCC1)C(=O)C(C)(C)C.
What is the InChIKey of 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one?
The InChIKey is SCJLFJRBOSSSJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO/c1-7-18-14(15(19)16(2,3)4)12-17(5,6)13-10-8-9-11-13/h13-14,18H,7-12H2,1-6H3.
What are the key properties of 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one?
6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one has a molecular weight of 267.46 g/mol, XLogP of 4.19, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopentyl-4-(ethylamino)-2,2,6-trimethylheptan-3-one is sourced from PubChem (CID 71154518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).