C43H44Cl2N6O2 — CID 71155679
6-chloro-3-[3-[1-(4-chlorophenyl)ethyl]-5-phenylimidazol-4-yl]-N-[2-(4-cyclohexylpiperazin-1-yl)-5-methoxyphenyl]-1H-indole-2-carboxamide (PubChem CID 71155679) has the molecular formula C43H44Cl2N6O2 and a molecular weight of 747.77 g/mol. Its IUPAC name is 6-chloro-3-[3-[1-(4-chlorophenyl)ethyl]-5-phenylimidazol-4-yl]-N-[2-(4-cyclohexylpiperazin-1-yl)-5-methoxyphenyl]-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-3-[3-[1-(4-chlorophenyl)ethyl]-5-phenylimidazol-4-yl]-N-[2-(4-cyclohexylpiperazin-1-yl)-5-methoxyphenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 71155679 |
| Molecular Formula | C43H44Cl2N6O2 |
| Molecular Weight | 747.77 g/mol |
| Exact Mass | 746.29 |
| IUPAC Name | 6-chloro-3-[3-[1-(4-chlorophenyl)ethyl]-5-phenylimidazol-4-yl]-N-[2-(4-cyclohexylpiperazin-1-yl)-5-methoxyphenyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc(N2CCN(C3CCCCC3)CC2)c(NC(=O)c2[nH]c3cc(Cl)ccc3c2-c2c(-c3ccccc3)ncn2C(C)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C43H44Cl2N6O2/c1-28(29-13-15-31(44)16-14-29)51-27-46-40(30-9-5-3-6-10-30)42(51)39-35-19-17-32(45)25-36(35)47-41(39)43(52)48-37-26-34(53-2)18-20-38(37)50-23-21-49(22-24-50)33-11-7-4-8-12-33/h3,5-6,9-10,13-20,25-28,33,47H,4,7-8,11-12,21-24H2,1-2H3,(H,48,52) |
| InChIKey | TYAYJUZECXEOCN-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 78.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.77 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|