C25H29NO3 — CID 71156180
4-benzyl-3-[(2R)-2-(4-phenylcyclohexyl)propanoyl]-1,3-oxazolidin-2-one (PubChem CID 71156180) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 4-benzyl-3-[(2R)-2-(4-phenylcyclohexyl)propanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[(2R)-2-(4-phenylcyclohexyl)propanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71156180 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 4-benzyl-3-[(2R)-2-(4-phenylcyclohexyl)propanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)OCC1Cc1ccccc1)C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H29NO3/c1-18(20-12-14-22(15-13-20)21-10-6-3-7-11-21)24(27)26-23(17-29-25(26)28)16-19-8-4-2-5-9-19/h2-11,18,20,22-23H,12-17H2,1H3/t18-,20?,22?,23?/m1/s1 |
| InChIKey | JHSGYSQDRWDYBZ-PYENRMDFSA-N |
| XLogP | 5.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |