C21H27N3O3 — CID 71156227
tert-butyl N-[[5-[(5-amino-2-pyridinyl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]carbamate (PubChem CID 71156227) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is tert-butyl N-[[5-[(5-amino-2-pyridinyl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[(5-amino-2-pyridinyl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71156227 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | tert-butyl N-[[5-[(5-amino-2-pyridinyl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCc2c(Oc3ccc(N)cn3)cccc21 |
| InChI | InChI=1S/C21H27N3O3/c1-21(2,3)27-20(25)24-12-14-6-4-8-17-16(14)7-5-9-18(17)26-19-11-10-15(22)13-23-19/h5,7,9-11,13-14H,4,6,8,12,22H2,1-3H3,(H,24,25) |
| InChIKey | MOCWCTGNNIENNU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_A(8)', 'substructure': 'N/A'} |
|---|