About cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol
cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol (PubChem CID 71156292) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol.
Molecular Properties
| Compound Name | cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol |
| PubChem CID | 71156292 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol |
| SMILES | Cc1ccccc1C(O)C1=CCC=CC=C1 |
| InChI | InChI=1S/C15H16O/c1-12-8-6-7-11-14(12)15(16)13-9-4-2-3-5-10-13/h2-4,6-11,15-16H,5H2,1H3 |
| InChIKey | FDUOPTRSWKNOSA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol?
The IUPAC name of cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol (CID 71156292) is cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol.
What is the SMILES notation for cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol?
The canonical SMILES for cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol is Cc1ccccc1C(O)C1=CCC=CC=C1.
What is the InChIKey of cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol?
The InChIKey is FDUOPTRSWKNOSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O/c1-12-8-6-7-11-14(12)15(16)13-9-4-2-3-5-10-13/h2-4,6-11,15-16H,5H2,1H3.
What are the key properties of cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol?
cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol has a molecular weight of 212.29 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta-1,4,6-trien-1-yl-(2-methylphenyl)methanol is sourced from PubChem (CID 71156292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).