C33H59N5 — CID 71156380
34,35,36,37,38-pentazaheptacyclo[12.12.7.13,7.18,12.116,20.121,25.128,32]octatriacontane (PubChem CID 71156380) has the molecular formula C33H59N5 and a molecular weight of 525.87 g/mol. Its IUPAC name is 34,35,36,37,38-pentazaheptacyclo[12.12.7.13,7.18,12.116,20.121,25.128,32]octatriacontane.
| Compound Name | 34,35,36,37,38-pentazaheptacyclo[12.12.7.13,7.18,12.116,20.121,25.128,32]octatriacontane |
|---|---|
| PubChem CID | 71156380 |
| Molecular Formula | C33H59N5 |
| Molecular Weight | 525.87 g/mol |
| Exact Mass | 525.48 |
| IUPAC Name | 34,35,36,37,38-pentazaheptacyclo[12.12.7.13,7.18,12.116,20.121,25.128,32]octatriacontane |
| SMILES | C1CC2CC3CC4CCCC(N4)C4CCCC(CC(CC(C1)N2)CC1CCCC(N1)C1CCCC(C3)N1)N4 |
| InChI | InChI=1S/C33H59N5/c1-6-24-16-22-18-26-8-2-12-30(35-26)31-13-3-9-27(36-31)20-23(17-25(7-1)34-24)21-29-11-5-15-33(38-29)32-14-4-10-28(19-22)37-32/h22-38H,1-21H2 |
| InChIKey | TZVKUBAJFFVLEU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.87 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |