About 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid
7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid (PubChem CID 71156408) has the molecular formula C22H25NO5
and a molecular weight of 383.44 g/mol. Its IUPAC name is 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid.
Molecular Properties
| Compound Name | 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid |
| PubChem CID | 71156408 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid |
| SMILES | O=C(O)CCCCCCOc1ccc(CC2CC(=O)NC2=O)c2ccccc12 |
| InChI | InChI=1S/C22H25NO5/c24-20-14-16(22(27)23-20)13-15-10-11-19(18-8-5-4-7-17(15)18)28-12-6-2-1-3-9-21(25)26/h4-5,7-8,10-11,16H,1-3,6,9,12-14H2,(H,25,26)(H,23,24,27) |
| InChIKey | YGTFQKQJUVDOIZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid?
The IUPAC name of 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid (CID 71156408) is 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid.
What is the SMILES notation for 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid?
The canonical SMILES for 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid is O=C(O)CCCCCCOc1ccc(CC2CC(=O)NC2=O)c2ccccc12.
What is the InChIKey of 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid?
The InChIKey is YGTFQKQJUVDOIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO5/c24-20-14-16(22(27)23-20)13-15-10-11-19(18-8-5-4-7-17(15)18)28-12-6-2-1-3-9-21(25)26/h4-5,7-8,10-11,16H,1-3,6,9,12-14H2,(H,25,26)(H,23,24,27).
What are the key properties of 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid?
7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid has a molecular weight of 383.44 g/mol, XLogP of 3.46, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]naphthalen-1-yl]oxyheptanoic acid is sourced from PubChem (CID 71156408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).