C10H13NO4 — CID 71156539
(8aS)-6-(2-hydroxyacetyl)-2,3,8,8a-tetrahydro-1H-indolizine-5,7-dione (PubChem CID 71156539) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is (8aS)-6-(2-hydroxyacetyl)-2,3,8,8a-tetrahydro-1H-indolizine-5,7-dione.
| Compound Name | (8aS)-6-(2-hydroxyacetyl)-2,3,8,8a-tetrahydro-1H-indolizine-5,7-dione |
|---|---|
| PubChem CID | 71156539 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (8aS)-6-(2-hydroxyacetyl)-2,3,8,8a-tetrahydro-1H-indolizine-5,7-dione |
| SMILES | O=C(CO)C1C(=O)C[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C10H13NO4/c12-5-8(14)9-7(13)4-6-2-1-3-11(6)10(9)15/h6,9,12H,1-5H2/t6-,9?/m0/s1 |
| InChIKey | LBSRARARXBPKLP-AADKRJSRSA-N |
| XLogP | -0.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|