About (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol
(Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol (PubChem CID 71157139) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol.
Molecular Properties
| Compound Name | (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol |
| PubChem CID | 71157139 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol |
| SMILES | CNCC1(C)CCC(C)(C/C(C)=C\O)C1 |
| InChI | InChI=1S/C13H25NO/c1-11(8-15)7-12(2)5-6-13(3,9-12)10-14-4/h8,14-15H,5-7,9-10H2,1-4H3/b11-8- |
| InChIKey | ZZVWGIRYNYUTNG-FLIBITNWSA-N |
| XLogP | 3.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol?
The IUPAC name of (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol (CID 71157139) is (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol.
What is the SMILES notation for (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol?
The canonical SMILES for (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol is CNCC1(C)CCC(C)(C/C(C)=C\O)C1.
What is the InChIKey of (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol?
The InChIKey is ZZVWGIRYNYUTNG-FLIBITNWSA-N. The full InChI is InChI=1S/C13H25NO/c1-11(8-15)7-12(2)5-6-13(3,9-12)10-14-4/h8,14-15H,5-7,9-10H2,1-4H3/b11-8-.
What are the key properties of (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol?
(Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol has a molecular weight of 211.35 g/mol, XLogP of 3.25, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[1,3-dimethyl-3-(methylaminomethyl)cyclopentyl]-2-methylprop-1-en-1-ol is sourced from PubChem (CID 71157139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).