C8H8F3NO3 — CID 71157345
3-[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 71157345) has the molecular formula C8H8F3NO3 and a molecular weight of 223.15 g/mol. Its IUPAC name is 3-[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71157345 |
| Molecular Formula | C8H8F3NO3 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 3-[(E)-4,4,4-trifluoro-3-methylbut-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C(=C\C(=O)N1CCOC1=O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO3/c1-5(8(9,10)11)4-6(13)12-2-3-15-7(12)14/h4H,2-3H2,1H3/b5-4+ |
| InChIKey | VXBIJWBCNMXWKT-SNAWJCMRSA-N |
| XLogP | 1.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|