C25H30ClN5O3 — CID 71157367
5-chloro-3-[[3-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)propyl-propylamino]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one (PubChem CID 71157367) has the molecular formula C25H30ClN5O3 and a molecular weight of 484.00 g/mol. Its IUPAC name is 5-chloro-3-[[3-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)propyl-propylamino]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one.
| Compound Name | 5-chloro-3-[[3-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)propyl-propylamino]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 71157367 |
| Molecular Formula | C25H30ClN5O3 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 5-chloro-3-[[3-(2,3-dihydro-[1,4]dioxino[2,3-c]pyridin-7-ylmethylamino)propyl-propylamino]methyl]-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
| SMILES | CCCN(CCCNCc1cc2c(cn1)OCCO2)CC1Cn2c(=O)ccc3ncc(Cl)c1c32 |
| InChI | InChI=1S/C25H30ClN5O3/c1-2-7-30(8-3-6-27-12-18-11-21-22(14-28-18)34-10-9-33-21)15-17-16-31-23(32)5-4-20-25(31)24(17)19(26)13-29-20/h4-5,11,13-14,17,27H,2-3,6-10,12,15-16H2,1H3 |
| InChIKey | RFATVWCYIQYXQA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|