About 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine
3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine (PubChem CID 71157475) has the molecular formula C22H29N3
and a molecular weight of 335.50 g/mol. Its IUPAC name is 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine |
| PubChem CID | 71157475 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine |
| SMILES | Cc1cc2c(nc1-c1ccc(C(C)C)nc1C)c(C)cn2CC(C)C |
| InChI | InChI=1S/C22H29N3/c1-13(2)11-25-12-16(6)22-20(25)10-15(5)21(24-22)18-8-9-19(14(3)4)23-17(18)7/h8-10,12-14H,11H2,1-7H3 |
| InChIKey | LKNAVERDSXPYPC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine?
The IUPAC name of 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine (CID 71157475) is 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine?
The canonical SMILES for 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine is Cc1cc2c(nc1-c1ccc(C(C)C)nc1C)c(C)cn2CC(C)C.
What is the InChIKey of 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine?
The InChIKey is LKNAVERDSXPYPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3/c1-13(2)11-25-12-16(6)22-20(25)10-15(5)21(24-22)18-8-9-19(14(3)4)23-17(18)7/h8-10,12-14H,11H2,1-7H3.
What are the key properties of 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine?
3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine has a molecular weight of 335.50 g/mol, XLogP of 5.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-5-(2-methyl-6-propan-2-yl-3-pyridinyl)-1-(2-methylpropyl)pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 71157475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).