C26H26FN9O3 — CID 71157511
5-[2-[4-[2-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]piperazin-1-yl]-3-pyridinyl]-5-oxopentanenitrile (PubChem CID 71157511) has the molecular formula C26H26FN9O3 and a molecular weight of 531.55 g/mol. Its IUPAC name is 5-[2-[4-[2-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]piperazin-1-yl]-3-pyridinyl]-5-oxopentanenitrile.
| Compound Name | 5-[2-[4-[2-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]piperazin-1-yl]-3-pyridinyl]-5-oxopentanenitrile |
|---|---|
| PubChem CID | 71157511 |
| Molecular Formula | C26H26FN9O3 |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 5-[2-[4-[2-[7-[amino-[(Z)-2-(methylideneamino)ethenyl]amino]-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]piperazin-1-yl]-3-pyridinyl]-5-oxopentanenitrile |
| SMILES | C=N/C=C\N(N)c1ncc(F)c2c(C(=O)C(=O)N3CCN(c4ncccc4C(=O)CCCC#N)CC3)c[nH]c12 |
| InChI | InChI=1S/C26H26FN9O3/c1-30-9-10-36(29)25-22-21(19(27)16-33-25)18(15-32-22)23(38)26(39)35-13-11-34(12-14-35)24-17(5-4-8-31-24)20(37)6-2-3-7-28/h4-5,8-10,15-16,32H,1-3,6,11-14,29H2/b10-9- |
| InChIKey | YOCXZVYDZPXXSZ-KTKRTIGZSA-N |
| XLogP | 2.36 |
| TPSA | 164.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|