C29H33F4NO3 — CID 71157562
(1S,2R)-1-(4-fluorophenyl)-2-[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]-7-(oxan-4-yl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 71157562) has the molecular formula C29H33F4NO3 and a molecular weight of 519.58 g/mol. Its IUPAC name is (1S,2R)-1-(4-fluorophenyl)-2-[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]-7-(oxan-4-yl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1S,2R)-1-(4-fluorophenyl)-2-[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]-7-(oxan-4-yl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 71157562 |
| Molecular Formula | C29H33F4NO3 |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | (1S,2R)-1-(4-fluorophenyl)-2-[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]-7-(oxan-4-yl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | Cc1cc([C@@H](C)O[C@H]2CN3C(=O)CC(C4CCOCC4)CC3[C@@H]2c2ccc(F)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H33F4NO3/c1-17-11-21(13-23(12-17)29(31,32)33)18(2)37-26-16-34-25(28(26)20-3-5-24(30)6-4-20)14-22(15-27(34)35)19-7-9-36-10-8-19/h3-6,11-13,18-19,22,25-26,28H,7-10,14-16H2,1-2H3/t18-,22?,25?,26+,28+/m1/s1 |
| InChIKey | FRPCARHYCTYUKT-WNNBOUPKSA-N |
| XLogP | 6.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |