About (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one
(3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one (PubChem CID 71158035) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one.
Molecular Properties
| Compound Name | (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one |
| PubChem CID | 71158035 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one |
| SMILES | C[C@H]1C(=O)OC([C@H](O)/C=C/C2CCCC2)C1O |
| InChI | InChI=1S/C13H20O4/c1-8-11(15)12(17-13(8)16)10(14)7-6-9-4-2-3-5-9/h6-12,14-15H,2-5H2,1H3/b7-6+/t8-,10-,11?,12?/m1/s1 |
| InChIKey | KGBZFEQKFOPSJD-BMNFHGHESA-N |
| XLogP | 1.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one?
The IUPAC name of (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one (CID 71158035) is (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one.
What is the SMILES notation for (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one?
The canonical SMILES for (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one is C[C@H]1C(=O)OC([C@H](O)/C=C/C2CCCC2)C1O.
What is the InChIKey of (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one?
The InChIKey is KGBZFEQKFOPSJD-BMNFHGHESA-N. The full InChI is InChI=1S/C13H20O4/c1-8-11(15)12(17-13(8)16)10(14)7-6-9-4-2-3-5-9/h6-12,14-15H,2-5H2,1H3/b7-6+/t8-,10-,11?,12?/m1/s1.
What are the key properties of (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one?
(3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one has a molecular weight of 240.30 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-[(E,1R)-3-cyclopentyl-1-hydroxyprop-2-enyl]-4-hydroxy-3-methyloxolan-2-one is sourced from PubChem (CID 71158035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).