C15H14F4N4S — CID 71158098
1-cyano-N'-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-N,N-diethylmethanimidamide (PubChem CID 71158098) has the molecular formula C15H14F4N4S and a molecular weight of 358.36 g/mol. Its IUPAC name is 1-cyano-N'-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-N,N-diethylmethanimidamide.
| Compound Name | 1-cyano-N'-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-N,N-diethylmethanimidamide |
|---|---|
| PubChem CID | 71158098 |
| Molecular Formula | C15H14F4N4S |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-cyano-N'-[4-cyano-2-fluoro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-N,N-diethylmethanimidamide |
| SMILES | CCN(CC)/C(C#N)=N/c1cc(SCC(F)(F)F)c(C#N)cc1F |
| InChI | InChI=1S/C15H14F4N4S/c1-3-23(4-2)14(8-21)22-12-6-13(24-9-15(17,18)19)10(7-20)5-11(12)16/h5-6H,3-4,9H2,1-2H3/b22-14+ |
| InChIKey | DLXIGZPUOHGAKG-HYARGMPZSA-N |
| XLogP | 4.25 |
| TPSA | 63.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|