C11H22NO2+ — CID 71158237
1-ethyl-1-pent-2-enylpyrrolidin-1-ium-3,4-diol (PubChem CID 71158237) has the molecular formula C11H22NO2+ and a molecular weight of 200.30 g/mol. Its IUPAC name is 1-ethyl-1-pent-2-enylpyrrolidin-1-ium-3,4-diol.
| Compound Name | 1-ethyl-1-pent-2-enylpyrrolidin-1-ium-3,4-diol |
|---|---|
| PubChem CID | 71158237 |
| Molecular Formula | C11H22NO2+ |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1-ethyl-1-pent-2-enylpyrrolidin-1-ium-3,4-diol |
| SMILES | CCC=CC[N+]1(CC)CC(O)C(O)C1 |
| InChI | InChI=1S/C11H22NO2/c1-3-5-6-7-12(4-2)8-10(13)11(14)9-12/h5-6,10-11,13-14H,3-4,7-9H2,1-2H3/q+1 |
| InChIKey | CQNVZJONWALWDW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|